sodium triethoxy(oxido)silane

C6H15NaO4Si — CID 22925347

IUPACsodium triethoxy(oxido)silane
SMILESCCO[Si]([O-])(OCC)OCC.[Na+]
InChIInChI=1S/C6H15O4Si.Na/c1-4-8-11(7,9-5-2)10-6-3;/h4-6H2,1-3H3;/q-1;+1
InChIKeyJBGOYYNPKIAWPT-UHFFFAOYSA-N
MW202.26 g/mol
LogP-3.10
Rot. Bonds6

About sodium triethoxy(oxido)silane

sodium triethoxy(oxido)silane (PubChem CID 22925347) has the molecular formula C6H15NaO4Si and a molecular weight of 202.26 g/mol. Its IUPAC name is sodium triethoxy(oxido)silane.

Molecular Properties

Compound Namesodium triethoxy(oxido)silane
PubChem CID22925347
Molecular FormulaC6H15NaO4Si
Molecular Weight202.26 g/mol
Exact Mass202.06
IUPAC Namesodium triethoxy(oxido)silane
SMILESCCO[Si]([O-])(OCC)OCC.[Na+]
InChIInChI=1S/C6H15O4Si.Na/c1-4-8-11(7,9-5-2)10-6-3;/h4-6H2,1-3H3;/q-1;+1
InChIKeyJBGOYYNPKIAWPT-UHFFFAOYSA-N
XLogP-3.10
TPSA50.75 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.26
LogP ≤ 5-3.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium triethoxy(oxido)silane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium triethoxy(oxido)silane?
The IUPAC name of sodium triethoxy(oxido)silane (CID 22925347) is sodium triethoxy(oxido)silane.
What is the SMILES notation for sodium triethoxy(oxido)silane?
The canonical SMILES for sodium triethoxy(oxido)silane is CCO[Si]([O-])(OCC)OCC.[Na+].
What is the InChIKey of sodium triethoxy(oxido)silane?
The InChIKey is JBGOYYNPKIAWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15O4Si.Na/c1-4-8-11(7,9-5-2)10-6-3;/h4-6H2,1-3H3;/q-1;+1.
What are the key properties of sodium triethoxy(oxido)silane?
sodium triethoxy(oxido)silane has a molecular weight of 202.26 g/mol, XLogP of -3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium triethoxy(oxido)silane is sourced from PubChem (CID 22925347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).