C18H26F5P — CID 22925407
bis(2-methylpentan-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane (PubChem CID 22925407) has the molecular formula C18H26F5P and a molecular weight of 368.37 g/mol. Its IUPAC name is bis(2-methylpentan-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane.
| Compound Name | bis(2-methylpentan-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
|---|---|
| PubChem CID | 22925407 |
| Molecular Formula | C18H26F5P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | bis(2-methylpentan-2-yl)-(2,3,4,5,6-pentafluorophenyl)phosphane |
| SMILES | CCCC(C)(C)P(c1c(F)c(F)c(F)c(F)c1F)C(C)(C)CCC |
| InChI | InChI=1S/C18H26F5P/c1-7-9-17(3,4)24(18(5,6)10-8-2)16-14(22)12(20)11(19)13(21)15(16)23/h7-10H2,1-6H3 |
| InChIKey | YEGIADWRKCFDAG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|