About 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol
2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol (PubChem CID 22925950) has the molecular formula C22H22O3
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol.
Molecular Properties
| Compound Name | 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol |
| PubChem CID | 22925950 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol |
| SMILES | Cc1cc(Cc2ccc(O)cc2)c(O)c(Cc2ccc(O)cc2)c1C |
| InChI | InChI=1S/C22H22O3/c1-14-11-18(12-16-3-7-19(23)8-4-16)22(25)21(15(14)2)13-17-5-9-20(24)10-6-17/h3-11,23-25H,12-13H2,1-2H3 |
| InChIKey | MHYCCESUHWMZHJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol?
The IUPAC name of 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol (CID 22925950) is 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol.
What is the SMILES notation for 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol?
The canonical SMILES for 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol is Cc1cc(Cc2ccc(O)cc2)c(O)c(Cc2ccc(O)cc2)c1C.
What is the InChIKey of 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol?
The InChIKey is MHYCCESUHWMZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O3/c1-14-11-18(12-16-3-7-19(23)8-4-16)22(25)21(15(14)2)13-17-5-9-20(24)10-6-17/h3-11,23-25H,12-13H2,1-2H3.
What are the key properties of 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol?
2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol has a molecular weight of 334.42 g/mol, XLogP of 4.60, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[(4-hydroxyphenyl)methyl]-3,4-dimethylphenol is sourced from PubChem (CID 22925950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).