C16H24Cl2SiZr-2 — CID 22926364
dichloro(dimethylsilylidene)zirconium;1,3-dimethylcyclopenta-1,3-diene;2,5-dimethylcyclopenta-1,3-diene (PubChem CID 22926364) has the molecular formula C16H24Cl2SiZr-2 and a molecular weight of 406.58 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;1,3-dimethylcyclopenta-1,3-diene;2,5-dimethylcyclopenta-1,3-diene.
| Compound Name | dichloro(dimethylsilylidene)zirconium;1,3-dimethylcyclopenta-1,3-diene;2,5-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 22926364 |
| Molecular Formula | C16H24Cl2SiZr-2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;1,3-dimethylcyclopenta-1,3-diene;2,5-dimethylcyclopenta-1,3-diene |
| SMILES | CC1=CC(C)[C-]=C1.CC1=[C-]CC(C)=C1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C7H9.C2H6Si.2ClH.Zr/c2*1-6-3-4-7(2)5-6;1-3-2;;;/h5H,3H2,1-2H3;3,5,7H,1-2H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | JJOAOZOPGBMUDU-UHFFFAOYSA-L |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|