C20H19N3O4S — CID 2292757
(5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-1-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2292757) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-1-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-1-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2292757 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-1-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(Cc2cccs2)C(=O)/C1=C/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H19N3O4S/c24-18-17(19(25)23(20(26)21-18)13-16-2-1-11-28-16)12-14-3-5-15(6-4-14)22-7-9-27-10-8-22/h1-6,11-12H,7-10,13H2,(H,21,24,26)/b17-12+ |
| InChIKey | VDBFWIMKCUBLTA-SFQUDFHCSA-N |
| XLogP | 2.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|