C21H21N3O5 — CID 2292764
5-(1,3-benzodioxol-5-ylmethyl)-1,3-dimethyl-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2292764) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-1,3-dimethyl-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-1,3-dimethyl-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2292764 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-1,3-dimethyl-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(CCc2ccncc2)(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C21H21N3O5/c1-23-18(25)21(19(26)24(2)20(23)27,8-5-14-6-9-22-10-7-14)12-15-3-4-16-17(11-15)29-13-28-16/h3-4,6-7,9-11H,5,8,12-13H2,1-2H3 |
| InChIKey | CWFWMYGFIUCWHW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|