About azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene
azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene (PubChem CID 22927970) has the molecular formula C6H5F2N
and a molecular weight of 129.11 g/mol. Its IUPAC name is azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene.
Molecular Properties
| Compound Name | azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene |
| PubChem CID | 22927970 |
| Molecular Formula | C6H5F2N |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene |
| SMILES | Fc1c(F)c2ccc1=2.N |
| InChI | InChI=1S/C6H2F2.H3N/c7-5-3-1-2-4(3)6(5)8;/h1-2H;1H3 |
| InChIKey | XACCZKAVDGTWET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene?
The IUPAC name of azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene (CID 22927970) is azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene.
What is the SMILES notation for azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene?
The canonical SMILES for azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene is Fc1c(F)c2ccc1=2.N.
What is the InChIKey of azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene?
The InChIKey is XACCZKAVDGTWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F2.H3N/c7-5-3-1-2-4(3)6(5)8;/h1-2H;1H3.
What are the key properties of azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene?
azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene has a molecular weight of 129.11 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-difluorobicyclo[2.2.0]hexa-1(4),2,5-triene is sourced from PubChem (CID 22927970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).