About N,N-dimethylmethanamine;trifluoroborane
N,N-dimethylmethanamine;trifluoroborane (PubChem CID 22930251) has the molecular formula C3H9BF3N
and a molecular weight of 126.92 g/mol. Its IUPAC name is N,N-dimethylmethanamine;trifluoroborane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;trifluoroborane |
| PubChem CID | 22930251 |
| Molecular Formula | C3H9BF3N |
| Molecular Weight | 126.92 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N,N-dimethylmethanamine;trifluoroborane |
| SMILES | CN(C)C.FB(F)F |
| InChI | InChI=1S/C3H9N.BF3/c1-4(2)3;2-1(3)4/h1-3H3; |
| InChIKey | QWDCGMCLKHZVNI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.92 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;trifluoroborane?
The IUPAC name of N,N-dimethylmethanamine;trifluoroborane (CID 22930251) is N,N-dimethylmethanamine;trifluoroborane.
What is the SMILES notation for N,N-dimethylmethanamine;trifluoroborane?
The canonical SMILES for N,N-dimethylmethanamine;trifluoroborane is CN(C)C.FB(F)F.
What is the InChIKey of N,N-dimethylmethanamine;trifluoroborane?
The InChIKey is QWDCGMCLKHZVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.BF3/c1-4(2)3;2-1(3)4/h1-3H3;.
What are the key properties of N,N-dimethylmethanamine;trifluoroborane?
N,N-dimethylmethanamine;trifluoroborane has a molecular weight of 126.92 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;trifluoroborane is sourced from PubChem (CID 22930251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).