About (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid
(2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid (PubChem CID 22930335) has the molecular formula C10H18O3S
and a molecular weight of 218.32 g/mol. Its IUPAC name is (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid.
Molecular Properties
| Compound Name | (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid |
| PubChem CID | 22930335 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid |
| SMILES | CCCC/C=C/C(C)=C(\C)S(=O)(=O)O |
| InChI | InChI=1S/C10H18O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h7-8H,4-6H2,1-3H3,(H,11,12,13)/b8-7+,10-9+ |
| InChIKey | OMUXQEBSSIZFAX-XBLVEGMJSA-N |
| XLogP | 2.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid?
The IUPAC name of (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid (CID 22930335) is (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid.
What is the SMILES notation for (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid?
The canonical SMILES for (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid is CCCC/C=C/C(C)=C(\C)S(=O)(=O)O.
What is the InChIKey of (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid?
The InChIKey is OMUXQEBSSIZFAX-XBLVEGMJSA-N. The full InChI is InChI=1S/C10H18O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h7-8H,4-6H2,1-3H3,(H,11,12,13)/b8-7+,10-9+.
What are the key properties of (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid?
(2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid has a molecular weight of 218.32 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-methylnona-2,4-diene-2-sulfonic acid is sourced from PubChem (CID 22930335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).