About (2-oxopentadecylamino) acetate
(2-oxopentadecylamino) acetate (PubChem CID 22930881) has the molecular formula C17H33NO3
and a molecular weight of 299.45 g/mol. Its IUPAC name is (2-oxopentadecylamino) acetate.
Molecular Properties
| Compound Name | (2-oxopentadecylamino) acetate |
| PubChem CID | 22930881 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | (2-oxopentadecylamino) acetate |
| SMILES | CCCCCCCCCCCCCC(=O)CNOC(C)=O |
| InChI | InChI=1S/C17H33NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(20)15-18-21-16(2)19/h18H,3-15H2,1-2H3 |
| InChIKey | DHHPUYDUGJKOTR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-oxopentadecylamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxopentadecylamino) acetate?
The IUPAC name of (2-oxopentadecylamino) acetate (CID 22930881) is (2-oxopentadecylamino) acetate.
What is the SMILES notation for (2-oxopentadecylamino) acetate?
The canonical SMILES for (2-oxopentadecylamino) acetate is CCCCCCCCCCCCCC(=O)CNOC(C)=O.
What is the InChIKey of (2-oxopentadecylamino) acetate?
The InChIKey is DHHPUYDUGJKOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(20)15-18-21-16(2)19/h18H,3-15H2,1-2H3.
What are the key properties of (2-oxopentadecylamino) acetate?
(2-oxopentadecylamino) acetate has a molecular weight of 299.45 g/mol, XLogP of 4.32, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxopentadecylamino) acetate is sourced from PubChem (CID 22930881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).