About N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide
N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide (PubChem CID 2293171) has the molecular formula C18H19ClN2O3
and a molecular weight of 346.81 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide.
Molecular Properties
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide |
| PubChem CID | 2293171 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-2-13-7-9-14(10-8-13)21-18(23)17(22)20-11-12-24-16-6-4-3-5-15(16)19/h3-10H,2,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | QPBKGEMAKMTQHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide?
The IUPAC name of N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide (CID 2293171) is N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide.
What is the SMILES notation for N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide?
The canonical SMILES for N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide is CCc1ccc(NC(=O)C(=O)NCCOc2ccccc2Cl)cc1.
What is the InChIKey of N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide?
The InChIKey is QPBKGEMAKMTQHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O3/c1-2-13-7-9-14(10-8-13)21-18(23)17(22)20-11-12-24-16-6-4-3-5-15(16)19/h3-10H,2,11-12H2,1H3,(H,20,22)(H,21,23).
What are the key properties of N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide?
N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide has a molecular weight of 346.81 g/mol, XLogP of 3.04, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-chlorophenoxy)ethyl]-N'-(4-ethylphenyl)oxamide is sourced from PubChem (CID 2293171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).