About bis(2-ethylhexyl) benzene-1,4-dicarboxylate
bis(2-ethylhexyl) benzene-1,4-dicarboxylate (PubChem CID 22932) has the molecular formula C24H38O4
and a molecular weight of 390.56 g/mol. Its IUPAC name is bis(2-ethylhexyl) benzene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| PubChem CID | 22932 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)OCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C24H38O4/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2/h13-16,19-20H,5-12,17-18H2,1-4H3 |
| InChIKey | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-ethylhexyl) benzene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) benzene-1,4-dicarboxylate?
The IUPAC name of bis(2-ethylhexyl) benzene-1,4-dicarboxylate (CID 22932) is bis(2-ethylhexyl) benzene-1,4-dicarboxylate.
What is the SMILES notation for bis(2-ethylhexyl) benzene-1,4-dicarboxylate?
The canonical SMILES for bis(2-ethylhexyl) benzene-1,4-dicarboxylate is CCCCC(CC)COC(=O)c1ccc(C(=O)OCC(CC)CCCC)cc1.
What is the InChIKey of bis(2-ethylhexyl) benzene-1,4-dicarboxylate?
The InChIKey is RWPICVVBGZBXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38O4/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2/h13-16,19-20H,5-12,17-18H2,1-4H3.
What are the key properties of bis(2-ethylhexyl) benzene-1,4-dicarboxylate?
bis(2-ethylhexyl) benzene-1,4-dicarboxylate has a molecular weight of 390.56 g/mol, XLogP of 6.43, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) benzene-1,4-dicarboxylate is sourced from PubChem (CID 22932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).