C16H23Cl2NO2 — CID 22932338
2-(3,5-dichloro-4-hydroxyphenyl)-N-(6-methylheptan-2-yl)acetamide (PubChem CID 22932338) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-hydroxyphenyl)-N-(6-methylheptan-2-yl)acetamide.
| Compound Name | 2-(3,5-dichloro-4-hydroxyphenyl)-N-(6-methylheptan-2-yl)acetamide |
|---|---|
| PubChem CID | 22932338 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-(3,5-dichloro-4-hydroxyphenyl)-N-(6-methylheptan-2-yl)acetamide |
| SMILES | CC(C)CCCC(C)NC(=O)Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NO2/c1-10(2)5-4-6-11(3)19-15(20)9-12-7-13(17)16(21)14(18)8-12/h7-8,10-11,21H,4-6,9H2,1-3H3,(H,19,20) |
| InChIKey | CNDRLBCUGYAQLR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |