C15H14N4O — CID 22934143
3-hydroxy-4-imidazol-1-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene (PubChem CID 22934143) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-hydroxy-4-imidazol-1-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene.
| Compound Name | 3-hydroxy-4-imidazol-1-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene |
|---|---|
| PubChem CID | 22934143 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-hydroxy-4-imidazol-1-yl-3,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaene |
| SMILES | On1c(-n2ccnc2)nc2c1-c1ccccc1CCC2 |
| InChI | InChI=1S/C15H14N4O/c20-19-14-12-6-2-1-4-11(12)5-3-7-13(14)17-15(19)18-9-8-16-10-18/h1-2,4,6,8-10,20H,3,5,7H2 |
| InChIKey | MMUSDIHIXNYIRO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|