About 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol
3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol (PubChem CID 22934598) has the molecular formula C10H11BrO3
and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol.
Molecular Properties
| Compound Name | 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol |
| PubChem CID | 22934598 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol |
| SMILES | Cc1ccc2c(c1)OC(O)(CBr)CO2 |
| InChI | InChI=1S/C10H11BrO3/c1-7-2-3-8-9(4-7)14-10(12,5-11)6-13-8/h2-4,12H,5-6H2,1H3 |
| InChIKey | DPCWSEYRDQPBLY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol?
The IUPAC name of 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol (CID 22934598) is 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol.
What is the SMILES notation for 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol?
The canonical SMILES for 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol is Cc1ccc2c(c1)OC(O)(CBr)CO2.
What is the InChIKey of 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol?
The InChIKey is DPCWSEYRDQPBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO3/c1-7-2-3-8-9(4-7)14-10(12,5-11)6-13-8/h2-4,12H,5-6H2,1H3.
What are the key properties of 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol?
3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol has a molecular weight of 259.10 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-6-methyl-2H-1,4-benzodioxin-3-ol is sourced from PubChem (CID 22934598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).