C11H11BrN2O — CID 22934720
5-bromo-N,N-dimethyl-1H-indole-3-carboxamide (PubChem CID 22934720) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-bromo-N,N-dimethyl-1H-indole-3-carboxamide.
| Compound Name | 5-bromo-N,N-dimethyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 22934720 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-bromo-N,N-dimethyl-1H-indole-3-carboxamide |
| SMILES | CN(C)C(=O)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C11H11BrN2O/c1-14(2)11(15)9-6-13-10-4-3-7(12)5-8(9)10/h3-6,13H,1-2H3 |
| InChIKey | RGEURSPSEKWPMJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |