C16H12N2O6 — CID 2293485
ethyl 4-(2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate (PubChem CID 2293485) has the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. Its IUPAC name is ethyl 4-(2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate.
| Compound Name | ethyl 4-(2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate |
|---|---|
| PubChem CID | 2293485 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | ethyl 4-(2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=CC(=C2C(=O)NC(=O)NC2=O)c2ccccc2O1 |
| InChI | InChI=1S/C16H12N2O6/c1-2-23-15(21)11-7-9(8-5-3-4-6-10(8)24-11)12-13(19)17-16(22)18-14(12)20/h3-7H,2H2,1H3,(H2,17,18,19,20,22) |
| InChIKey | RCIXBDOAQLQFFM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|