About bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate
bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate (PubChem CID 22935075) has the molecular formula C28H34FIO3S
and a molecular weight of 596.55 g/mol. Its IUPAC name is bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate |
| PubChem CID | 22935075 |
| Molecular Formula | C28H34FIO3S |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate |
| SMILES | CCC(C)(C)c1ccc([I+]c2ccc(C(C)(C)CC)cc2)cc1.O=S(=O)([O-])c1ccccc1F |
| InChI | InChI=1S/C22H30I.C6H5FO3S/c1-7-21(3,4)17-9-13-19(14-10-17)23-20-15-11-18(12-16-20)22(5,6)8-2;7-5-3-1-2-4-6(5)11(8,9)10/h9-16H,7-8H2,1-6H3;1-4H,(H,8,9,10)/q+1;/p-1 |
| InChIKey | VKLOLOBOSGWUGS-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate?
The IUPAC name of bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate (CID 22935075) is bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate.
What is the SMILES notation for bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate?
The canonical SMILES for bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate is CCC(C)(C)c1ccc([I+]c2ccc(C(C)(C)CC)cc2)cc1.O=S(=O)([O-])c1ccccc1F.
What is the InChIKey of bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate?
The InChIKey is VKLOLOBOSGWUGS-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H30I.C6H5FO3S/c1-7-21(3,4)17-9-13-19(14-10-17)23-20-15-11-18(12-16-20)22(5,6)8-2;7-5-3-1-2-4-6(5)11(8,9)10/h9-16H,7-8H2,1-6H3;1-4H,(H,8,9,10)/q+1;/p-1.
What are the key properties of bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate?
bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate has a molecular weight of 596.55 g/mol, XLogP of 3.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(2-methylbutan-2-yl)phenyl]iodanium;2-fluorobenzenesulfonate is sourced from PubChem (CID 22935075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).