C13H15BrO2 — CID 22935579
5-bromo-2,2,4,6,7-pentamethyl-1-benzofuran-3-one (PubChem CID 22935579) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is 5-bromo-2,2,4,6,7-pentamethyl-1-benzofuran-3-one.
| Compound Name | 5-bromo-2,2,4,6,7-pentamethyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 22935579 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-bromo-2,2,4,6,7-pentamethyl-1-benzofuran-3-one |
| SMILES | Cc1c(C)c2c(c(C)c1Br)C(=O)C(C)(C)O2 |
| InChI | InChI=1S/C13H15BrO2/c1-6-7(2)11-9(8(3)10(6)14)12(15)13(4,5)16-11/h1-5H3 |
| InChIKey | LKOQWIPSKYTORD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |