2-(ethylsulfamoyl)acetic acid

C4H9NO4S — CID 22936175

IUPAC2-(ethylsulfamoyl)acetic acid
SMILESCCNS(=O)(=O)CC(=O)O
InChIInChI=1S/C4H9NO4S/c1-2-5-10(8,9)3-4(6)7/h5H,2-3H2,1H3,(H,6,7)
InChIKeyZUTJQXSCGYUTPC-UHFFFAOYSA-N
MW167.19 g/mol
LogP-0.99
Rot. Bonds4

About 2-(ethylsulfamoyl)acetic acid

2-(ethylsulfamoyl)acetic acid (PubChem CID 22936175) has the molecular formula C4H9NO4S and a molecular weight of 167.19 g/mol. Its IUPAC name is 2-(ethylsulfamoyl)acetic acid.

Molecular Properties

Compound Name2-(ethylsulfamoyl)acetic acid
PubChem CID22936175
Molecular FormulaC4H9NO4S
Molecular Weight167.19 g/mol
Exact Mass167.03
IUPAC Name2-(ethylsulfamoyl)acetic acid
SMILESCCNS(=O)(=O)CC(=O)O
InChIInChI=1S/C4H9NO4S/c1-2-5-10(8,9)3-4(6)7/h5H,2-3H2,1H3,(H,6,7)
InChIKeyZUTJQXSCGYUTPC-UHFFFAOYSA-N
XLogP-0.99
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.19
LogP ≤ 5-0.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(ethylsulfamoyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(ethylsulfamoyl)acetic acid?
The IUPAC name of 2-(ethylsulfamoyl)acetic acid (CID 22936175) is 2-(ethylsulfamoyl)acetic acid.
What is the SMILES notation for 2-(ethylsulfamoyl)acetic acid?
The canonical SMILES for 2-(ethylsulfamoyl)acetic acid is CCNS(=O)(=O)CC(=O)O.
What is the InChIKey of 2-(ethylsulfamoyl)acetic acid?
The InChIKey is ZUTJQXSCGYUTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO4S/c1-2-5-10(8,9)3-4(6)7/h5H,2-3H2,1H3,(H,6,7).
What are the key properties of 2-(ethylsulfamoyl)acetic acid?
2-(ethylsulfamoyl)acetic acid has a molecular weight of 167.19 g/mol, XLogP of -0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylsulfamoyl)acetic acid is sourced from PubChem (CID 22936175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).