About 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one
5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one (PubChem CID 22936880) has the molecular formula C14H9N3O4
and a molecular weight of 283.24 g/mol. Its IUPAC name is 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one |
| PubChem CID | 22936880 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2c(Oc3ccc([N+](=O)[O-])cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C14H9N3O4/c18-13-6-5-11-12(7-8-15-14(11)16-13)21-10-3-1-9(2-4-10)17(19)20/h1-8H,(H,15,16,18) |
| InChIKey | JCZPVJXIVVCQIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one?
The IUPAC name of 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one (CID 22936880) is 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one is O=c1ccc2c(Oc3ccc([N+](=O)[O-])cc3)ccnc2[nH]1.
What is the InChIKey of 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one?
The InChIKey is JCZPVJXIVVCQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O4/c18-13-6-5-11-12(7-8-15-14(11)16-13)21-10-3-1-9(2-4-10)17(19)20/h1-8H,(H,15,16,18).
What are the key properties of 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one?
5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one has a molecular weight of 283.24 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-nitrophenoxy)-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 22936880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).