About 4-hydroxybutyl methyl carbonate
4-hydroxybutyl methyl carbonate (PubChem CID 22937117) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-hydroxybutyl methyl carbonate.
Molecular Properties
| Compound Name | 4-hydroxybutyl methyl carbonate |
| PubChem CID | 22937117 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4-hydroxybutyl methyl carbonate |
| SMILES | COC(=O)OCCCCO |
| InChI | InChI=1S/C6H12O4/c1-9-6(8)10-5-3-2-4-7/h7H,2-5H2,1H3 |
| InChIKey | LYFFZMBJYLSUTF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl methyl carbonate?
The IUPAC name of 4-hydroxybutyl methyl carbonate (CID 22937117) is 4-hydroxybutyl methyl carbonate.
What is the SMILES notation for 4-hydroxybutyl methyl carbonate?
The canonical SMILES for 4-hydroxybutyl methyl carbonate is COC(=O)OCCCCO.
What is the InChIKey of 4-hydroxybutyl methyl carbonate?
The InChIKey is LYFFZMBJYLSUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4/c1-9-6(8)10-5-3-2-4-7/h7H,2-5H2,1H3.
What are the key properties of 4-hydroxybutyl methyl carbonate?
4-hydroxybutyl methyl carbonate has a molecular weight of 148.16 g/mol, XLogP of 0.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl methyl carbonate is sourced from PubChem (CID 22937117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).