About 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide
2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide (PubChem CID 22937154) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide |
| PubChem CID | 22937154 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1ccc(CCO)c(C(N)=O)c1CCO |
| InChI | InChI=1S/C12H16N2O4/c13-11(17)9-2-1-7(3-5-15)10(12(14)18)8(9)4-6-16/h1-2,15-16H,3-6H2,(H2,13,17)(H2,14,18) |
| InChIKey | WEPRRSOHGYERPY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide?
The IUPAC name of 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide (CID 22937154) is 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide?
The canonical SMILES for 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide is NC(=O)c1ccc(CCO)c(C(N)=O)c1CCO.
What is the InChIKey of 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide?
The InChIKey is WEPRRSOHGYERPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c13-11(17)9-2-1-7(3-5-15)10(12(14)18)8(9)4-6-16/h1-2,15-16H,3-6H2,(H2,13,17)(H2,14,18).
What are the key properties of 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide?
2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide has a molecular weight of 252.27 g/mol, XLogP of -1.05, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(2-hydroxyethyl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 22937154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).