C23H26F3N5O — CID 2293724
N-[3-(diethylamino)propyl]-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide (PubChem CID 2293724) has the molecular formula C23H26F3N5O and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide |
|---|---|
| PubChem CID | 2293724 |
| Molecular Formula | C23H26F3N5O |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[3-(diethylamino)propyl]-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,13,15-heptaene-14-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc2nc3c(c(C(F)(F)F)n2n1)CCc1ccccc1-3 |
| InChI | InChI=1S/C23H26F3N5O/c1-3-30(4-2)13-7-12-27-22(32)18-14-19-28-20-16-9-6-5-8-15(16)10-11-17(20)21(23(24,25)26)31(19)29-18/h5-6,8-9,14H,3-4,7,10-13H2,1-2H3,(H,27,32) |
| InChIKey | JBASNHDIWKKDSS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|