C9H7F4NOS — CID 2293735
(Z)-3-amino-4,4,5,5-tetrafluoro-1-thiophen-2-ylpent-2-en-1-one (PubChem CID 2293735) has the molecular formula C9H7F4NOS and a molecular weight of 253.22 g/mol. Its IUPAC name is (Z)-3-amino-4,4,5,5-tetrafluoro-1-thiophen-2-ylpent-2-en-1-one.
| Compound Name | (Z)-3-amino-4,4,5,5-tetrafluoro-1-thiophen-2-ylpent-2-en-1-one |
|---|---|
| PubChem CID | 2293735 |
| Molecular Formula | C9H7F4NOS |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | (Z)-3-amino-4,4,5,5-tetrafluoro-1-thiophen-2-ylpent-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1cccs1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H7F4NOS/c10-8(11)9(12,13)7(14)4-5(15)6-2-1-3-16-6/h1-4,8H,14H2/b7-4- |
| InChIKey | QHSMZEAYHQYGHS-DAXSKMNVSA-N |
| XLogP | 2.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|