About 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride
1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride (PubChem CID 22937574) has the molecular formula C13H17Cl3O
and a molecular weight of 295.64 g/mol. Its IUPAC name is 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride.
Molecular Properties
| Compound Name | 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride |
| PubChem CID | 22937574 |
| Molecular Formula | C13H17Cl3O |
| Molecular Weight | 295.64 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride |
| SMILES | Cl.Clc1cccc(Cl)c1COC1CCCCC1 |
| InChI | InChI=1S/C13H16Cl2O.ClH/c14-12-7-4-8-13(15)11(12)9-16-10-5-2-1-3-6-10;/h4,7-8,10H,1-3,5-6,9H2;1H |
| InChIKey | DRTJSDAHQWSNFI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride?
The IUPAC name of 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride (CID 22937574) is 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride.
What is the SMILES notation for 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride?
The canonical SMILES for 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride is Cl.Clc1cccc(Cl)c1COC1CCCCC1.
What is the InChIKey of 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride?
The InChIKey is DRTJSDAHQWSNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2O.ClH/c14-12-7-4-8-13(15)11(12)9-16-10-5-2-1-3-6-10;/h4,7-8,10H,1-3,5-6,9H2;1H.
What are the key properties of 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride?
1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride has a molecular weight of 295.64 g/mol, XLogP of 5.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-(cyclohexyloxymethyl)benzene;hydrochloride is sourced from PubChem (CID 22937574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).