About ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate
ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate (PubChem CID 22937876) has the molecular formula C9H14N2O4
and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate |
| PubChem CID | 22937876 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC)c(=O)n(C)n1C |
| InChI | InChI=1S/C9H14N2O4/c1-5-15-9(13)6-7(14-4)8(12)11(3)10(6)2/h5H2,1-4H3 |
| InChIKey | RJFZRFVDNQOKQD-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate?
The IUPAC name of ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate (CID 22937876) is ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate.
What is the SMILES notation for ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate?
The canonical SMILES for ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate is CCOC(=O)c1c(OC)c(=O)n(C)n1C.
What is the InChIKey of ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate?
The InChIKey is RJFZRFVDNQOKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O4/c1-5-15-9(13)6-7(14-4)8(12)11(3)10(6)2/h5H2,1-4H3.
What are the key properties of ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate?
ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate has a molecular weight of 214.22 g/mol, XLogP of -0.09, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methoxy-1,2-dimethyl-5-oxopyrazole-3-carboxylate is sourced from PubChem (CID 22937876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).