About 4-cyclohexylmorpholine
4-cyclohexylmorpholine (PubChem CID 22938) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-cyclohexylmorpholine.
Molecular Properties
| Compound Name | 4-cyclohexylmorpholine |
| PubChem CID | 22938 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-cyclohexylmorpholine |
| SMILES | C1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C10H19NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h10H,1-9H2 |
| InChIKey | BRKHZWFIIVVNTA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylmorpholine?
The IUPAC name of 4-cyclohexylmorpholine (CID 22938) is 4-cyclohexylmorpholine.
What is the SMILES notation for 4-cyclohexylmorpholine?
The canonical SMILES for 4-cyclohexylmorpholine is C1CCC(N2CCOCC2)CC1.
What is the InChIKey of 4-cyclohexylmorpholine?
The InChIKey is BRKHZWFIIVVNTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h10H,1-9H2.
What are the key properties of 4-cyclohexylmorpholine?
4-cyclohexylmorpholine has a molecular weight of 169.27 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylmorpholine is sourced from PubChem (CID 22938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).