About 2-methoxyethoxymethyl ethaneperoxoate
2-methoxyethoxymethyl ethaneperoxoate (PubChem CID 22938292) has the molecular formula C6H12O5
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-methoxyethoxymethyl ethaneperoxoate.
Molecular Properties
| Compound Name | 2-methoxyethoxymethyl ethaneperoxoate |
| PubChem CID | 22938292 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-methoxyethoxymethyl ethaneperoxoate |
| SMILES | COCCOCOOC(C)=O |
| InChI | InChI=1S/C6H12O5/c1-6(7)11-10-5-9-4-3-8-2/h3-5H2,1-2H3 |
| InChIKey | BPOSORQRGGVLMH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethoxymethyl ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethoxymethyl ethaneperoxoate?
The IUPAC name of 2-methoxyethoxymethyl ethaneperoxoate (CID 22938292) is 2-methoxyethoxymethyl ethaneperoxoate.
What is the SMILES notation for 2-methoxyethoxymethyl ethaneperoxoate?
The canonical SMILES for 2-methoxyethoxymethyl ethaneperoxoate is COCCOCOOC(C)=O.
What is the InChIKey of 2-methoxyethoxymethyl ethaneperoxoate?
The InChIKey is BPOSORQRGGVLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O5/c1-6(7)11-10-5-9-4-3-8-2/h3-5H2,1-2H3.
What are the key properties of 2-methoxyethoxymethyl ethaneperoxoate?
2-methoxyethoxymethyl ethaneperoxoate has a molecular weight of 164.16 g/mol, XLogP of 0.10, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethoxymethyl ethaneperoxoate is sourced from PubChem (CID 22938292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).