About (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol
(5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol (PubChem CID 22938879) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol.
Molecular Properties
| Compound Name | (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol |
| PubChem CID | 22938879 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol |
| SMILES | CCCn1c(CO)nnc1SC |
| InChI | InChI=1S/C7H13N3OS/c1-3-4-10-6(5-11)8-9-7(10)12-2/h11H,3-5H2,1-2H3 |
| InChIKey | DNLCIUKTPGAQOA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol?
The IUPAC name of (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol (CID 22938879) is (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol.
What is the SMILES notation for (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol?
The canonical SMILES for (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol is CCCn1c(CO)nnc1SC.
What is the InChIKey of (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol?
The InChIKey is DNLCIUKTPGAQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-3-4-10-6(5-11)8-9-7(10)12-2/h11H,3-5H2,1-2H3.
What are the key properties of (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol?
(5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol has a molecular weight of 187.27 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylsulfanyl-4-propyl-1,2,4-triazol-3-yl)methanol is sourced from PubChem (CID 22938879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).