About 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine
1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine (PubChem CID 2293923) has the molecular formula C20H26N2O3S
and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine |
| PubChem CID | 2293923 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2O3S/c1-16-13-19(25-3)20(14-17(16)2)26(23,24)22-11-9-21(10-12-22)15-18-7-5-4-6-8-18/h4-8,13-14H,9-12,15H2,1-3H3 |
| InChIKey | AGGWNFLVAPHRRO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine?
The IUPAC name of 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine (CID 2293923) is 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine.
What is the SMILES notation for 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine?
The canonical SMILES for 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine is COc1cc(C)c(C)cc1S(=O)(=O)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine?
The InChIKey is AGGWNFLVAPHRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O3S/c1-16-13-19(25-3)20(14-17(16)2)26(23,24)22-11-9-21(10-12-22)15-18-7-5-4-6-8-18/h4-8,13-14H,9-12,15H2,1-3H3.
What are the key properties of 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine?
1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine has a molecular weight of 374.51 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(2-methoxy-4,5-dimethylphenyl)sulfonylpiperazine is sourced from PubChem (CID 2293923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).