About 1,3-benzothiazin-2-one
1,3-benzothiazin-2-one (PubChem CID 22939514) has the molecular formula C8H5NOS
and a molecular weight of 163.20 g/mol. Its IUPAC name is 1,3-benzothiazin-2-one.
Molecular Properties
| Compound Name | 1,3-benzothiazin-2-one |
| PubChem CID | 22939514 |
| Molecular Formula | C8H5NOS |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 1,3-benzothiazin-2-one |
| SMILES | O=c1ncc2ccccc2s1 |
| InChI | InChI=1S/C8H5NOS/c10-8-9-5-6-3-1-2-4-7(6)11-8/h1-5H |
| InChIKey | VZDZFMYULLOZAY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-benzothiazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazin-2-one?
The IUPAC name of 1,3-benzothiazin-2-one (CID 22939514) is 1,3-benzothiazin-2-one.
What is the SMILES notation for 1,3-benzothiazin-2-one?
The canonical SMILES for 1,3-benzothiazin-2-one is O=c1ncc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazin-2-one?
The InChIKey is VZDZFMYULLOZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS/c10-8-9-5-6-3-1-2-4-7(6)11-8/h1-5H.
What are the key properties of 1,3-benzothiazin-2-one?
1,3-benzothiazin-2-one has a molecular weight of 163.20 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazin-2-one is sourced from PubChem (CID 22939514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).