About 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium
6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium (PubChem CID 22940000) has the molecular formula C13H9Cl3N2O2
and a molecular weight of 331.59 g/mol. Its IUPAC name is 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium.
Molecular Properties
| Compound Name | 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium |
| PubChem CID | 22940000 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium |
| SMILES | [O-][n+]1nc(Oc2ccccc2C2CC2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl3N2O2/c14-11-5-6-12(17-18(11)19)20-10-4-2-1-3-8(10)9-7-13(9,15)16/h1-6,9H,7H2 |
| InChIKey | LBYVHPNVYZFQCR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium?
The IUPAC name of 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium (CID 22940000) is 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium.
What is the SMILES notation for 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium?
The canonical SMILES for 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium is [O-][n+]1nc(Oc2ccccc2C2CC2(Cl)Cl)ccc1Cl.
What is the InChIKey of 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium?
The InChIKey is LBYVHPNVYZFQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl3N2O2/c14-11-5-6-12(17-18(11)19)20-10-4-2-1-3-8(10)9-7-13(9,15)16/h1-6,9H,7H2.
What are the key properties of 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium?
6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium has a molecular weight of 331.59 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[2-(2,2-dichlorocyclopropyl)phenoxy]-1-oxidopyridazin-1-ium is sourced from PubChem (CID 22940000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).