C15H14N3O4- — CID 2294161
(Z)-4-[(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate (PubChem CID 2294161) has the molecular formula C15H14N3O4- and a molecular weight of 300.29 g/mol. Its IUPAC name is (Z)-4-[(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-[(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2294161 |
| Molecular Formula | C15H14N3O4- |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (Z)-4-[(1,3-dimethyl-5-oxo-2-phenylpyrazol-4-yl)amino]-4-oxobut-2-enoate |
| SMILES | Cc1c(NC(=O)/C=C\C(=O)[O-])c(=O)n(C)n1-c1ccccc1 |
| InChI | InChI=1S/C15H15N3O4/c1-10-14(16-12(19)8-9-13(20)21)15(22)17(2)18(10)11-6-4-3-5-7-11/h3-9H,1-2H3,(H,16,19)(H,20,21)/p-1/b9-8- |
| InChIKey | YEKSHRUNXIJUDF-HJWRWDBZSA-M |
| XLogP | -0.27 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|