C18H38O6 — CID 22942429
(2R,3R,4R,5S)-1,6-di(butan-2-yloxy)-2,3,4,5-tetramethoxyhexane (PubChem CID 22942429) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1,6-di(butan-2-yloxy)-2,3,4,5-tetramethoxyhexane.
| Compound Name | (2R,3R,4R,5S)-1,6-di(butan-2-yloxy)-2,3,4,5-tetramethoxyhexane |
|---|---|
| PubChem CID | 22942429 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | (2R,3R,4R,5S)-1,6-di(butan-2-yloxy)-2,3,4,5-tetramethoxyhexane |
| SMILES | CCC(C)OC[C@H](OC)[C@@H](OC)[C@H](OC)[C@@H](COC(C)CC)OC |
| InChI | InChI=1S/C18H38O6/c1-9-13(3)23-11-15(19-5)17(21-7)18(22-8)16(20-6)12-24-14(4)10-2/h13-18H,9-12H2,1-8H3/t13?,14?,15-,16+,17-,18-/m1/s1 |
| InChIKey | VXMBPKQQIPWZHP-RPUAIKFZSA-N |
| XLogP | 2.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |