C21H44O6 — CID 22942432
(2S,3R,4R,5R)-1,3,6-tri(butan-2-yloxy)-2,4,5-trimethoxyhexane (PubChem CID 22942432) has the molecular formula C21H44O6 and a molecular weight of 392.58 g/mol. Its IUPAC name is (2S,3R,4R,5R)-1,3,6-tri(butan-2-yloxy)-2,4,5-trimethoxyhexane.
| Compound Name | (2S,3R,4R,5R)-1,3,6-tri(butan-2-yloxy)-2,4,5-trimethoxyhexane |
|---|---|
| PubChem CID | 22942432 |
| Molecular Formula | C21H44O6 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (2S,3R,4R,5R)-1,3,6-tri(butan-2-yloxy)-2,4,5-trimethoxyhexane |
| SMILES | CCC(C)OC[C@H](OC)[C@@H](OC(C)CC)[C@H](OC)[C@@H](COC(C)CC)OC |
| InChI | InChI=1S/C21H44O6/c1-10-15(4)25-13-18(22-7)20(24-9)21(27-17(6)12-3)19(23-8)14-26-16(5)11-2/h15-21H,10-14H2,1-9H3/t15?,16?,17?,18-,19+,20-,21-/m1/s1 |
| InChIKey | YTUCKNOZMZAZBQ-ZZYOGYPHSA-N |
| XLogP | 3.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |