C17H25N7O7S2 — CID 22942454
4-[[4-[2-(ethylsulfonylamino)ethyl-methylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 22942454) has the molecular formula C17H25N7O7S2 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[[4-[2-(ethylsulfonylamino)ethyl-methylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-[2-(ethylsulfonylamino)ethyl-methylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22942454 |
| Molecular Formula | C17H25N7O7S2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[[4-[2-(ethylsulfonylamino)ethyl-methylamino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CCS(=O)(=O)NCCN(C)c1nc(NCCS(=O)(=O)O)nc(Nc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C17H25N7O7S2/c1-3-32(27,28)19-8-10-24(2)17-22-15(18-9-11-33(29,30)31)21-16(23-17)20-13-6-4-12(5-7-13)14(25)26/h4-7,19H,3,8-11H2,1-2H3,(H,25,26)(H,29,30,31)(H2,18,20,21,22,23) |
| InChIKey | GHXIYBADQJXAMZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 203.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|