About dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+)
dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) (PubChem CID 22942575) has the molecular formula C7H14N2OY+
and a molecular weight of 231.11 g/mol. Its IUPAC name is dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+).
Molecular Properties
| Compound Name | dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) |
| PubChem CID | 22942575 |
| Molecular Formula | C7H14N2OY+ |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) |
| SMILES | C/C=C(\C)C([NH-])=O.C[N-]C.[Y+3] |
| InChI | InChI=1S/C5H9NO.C2H6N.Y/c1-3-4(2)5(6)7;1-3-2;/h3H,1-2H3,(H2,6,7);1-2H3;/q;-1;+3/p-1/b4-3+;; |
| InChIKey | RHBDRIZXOZAXRM-CZEFNJPISA-M |
| XLogP | 2.15 |
| TPSA | 54.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+)?
The IUPAC name of dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) (CID 22942575) is dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+).
What is the SMILES notation for dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+)?
The canonical SMILES for dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) is C/C=C(\C)C([NH-])=O.C[N-]C.[Y+3].
What is the InChIKey of dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+)?
The InChIKey is RHBDRIZXOZAXRM-CZEFNJPISA-M. The full InChI is InChI=1S/C5H9NO.C2H6N.Y/c1-3-4(2)5(6)7;1-3-2;/h3H,1-2H3,(H2,6,7);1-2H3;/q;-1;+3/p-1/b4-3+;;.
What are the key properties of dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+)?
dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) has a molecular weight of 231.11 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanide;[(E)-2-methylbut-2-enoyl]azanide;yttrium(3+) is sourced from PubChem (CID 22942575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).