About CID 22942586
CID 22942586 (PubChem CID 22942586) has the molecular formula C15H21O3Si
and a molecular weight of 277.42 g/mol.
Molecular Properties
| Compound Name | CID 22942586 |
| PubChem CID | 22942586 |
| Molecular Formula | C15H21O3Si |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | — |
| SMILES | OCc1ccc(OC2CCCC(CC[Si])C2O)cc1 |
| InChI | InChI=1S/C15H21O3Si/c16-10-11-4-6-13(7-5-11)18-14-3-1-2-12(8-9-19)15(14)17/h4-7,12,14-17H,1-3,8-10H2 |
| InChIKey | UQCSXKGKTGJICK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22942586 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22942586?
The IUPAC name of CID 22942586 (CID 22942586) is not available.
What is the SMILES notation for CID 22942586?
The canonical SMILES for CID 22942586 is OCc1ccc(OC2CCCC(CC[Si])C2O)cc1.
What is the InChIKey of CID 22942586?
The InChIKey is UQCSXKGKTGJICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21O3Si/c16-10-11-4-6-13(7-5-11)18-14-3-1-2-12(8-9-19)15(14)17/h4-7,12,14-17H,1-3,8-10H2.
What are the key properties of CID 22942586?
CID 22942586 has a molecular weight of 277.42 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22942586 is sourced from PubChem (CID 22942586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).