C19H7F3O7 — CID 22942676
12-methyl-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone (PubChem CID 22942676) has the molecular formula C19H7F3O7 and a molecular weight of 404.25 g/mol. Its IUPAC name is 12-methyl-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone.
| Compound Name | 12-methyl-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 22942676 |
| Molecular Formula | C19H7F3O7 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 12-methyl-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,16,18-tetrone |
| SMILES | CC1(C(F)(F)F)c2cc3c(cc2Oc2cc4c(cc21)C(=O)OC4=O)C(=O)OC3=O |
| InChI | InChI=1S/C19H7F3O7/c1-18(19(20,21)22)10-2-6-8(16(25)28-14(6)23)4-12(10)27-13-5-9-7(3-11(13)18)15(24)29-17(9)26/h2-5H,1H3 |
| InChIKey | LRKPQRUJEBODRO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|