About pentane-2,4-diimine
pentane-2,4-diimine (PubChem CID 22942759) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is pentane-2,4-diimine.
Molecular Properties
| Compound Name | pentane-2,4-diimine |
| PubChem CID | 22942759 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | pentane-2,4-diimine |
| SMILES | [H]/N=C(\C)C/C(C)=N/[H] |
| InChI | InChI=1S/C5H10N2/c1-4(6)3-5(2)7/h6-7H,3H2,1-2H3/b6-4+,7-5+ |
| InChIKey | CJRWFMVDCNBYFQ-YDFGWWAZSA-N |
| XLogP | 1.46 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-diimine?
The IUPAC name of pentane-2,4-diimine (CID 22942759) is pentane-2,4-diimine.
What is the SMILES notation for pentane-2,4-diimine?
The canonical SMILES for pentane-2,4-diimine is [H]/N=C(\C)C/C(C)=N/[H].
What is the InChIKey of pentane-2,4-diimine?
The InChIKey is CJRWFMVDCNBYFQ-YDFGWWAZSA-N. The full InChI is InChI=1S/C5H10N2/c1-4(6)3-5(2)7/h6-7H,3H2,1-2H3/b6-4+,7-5+.
What are the key properties of pentane-2,4-diimine?
pentane-2,4-diimine has a molecular weight of 98.15 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-diimine is sourced from PubChem (CID 22942759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).