C22H30N2O2 — CID 22942829
2,4-bis[(1,2,6-trimethyl-4-pyridinylidene)methyl]cyclobutane-1,3-diol (PubChem CID 22942829) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2,4-bis[(1,2,6-trimethyl-4-pyridinylidene)methyl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[(1,2,6-trimethyl-4-pyridinylidene)methyl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 22942829 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2,4-bis[(1,2,6-trimethyl-4-pyridinylidene)methyl]cyclobutane-1,3-diol |
| SMILES | CC1=CC(=CC2C(O)C(C=C3C=C(C)N(C)C(C)=C3)C2O)C=C(C)N1C |
| InChI | InChI=1S/C22H30N2O2/c1-13-7-17(8-14(2)23(13)5)11-19-21(25)20(22(19)26)12-18-9-15(3)24(6)16(4)10-18/h7-12,19-22,25-26H,1-6H3 |
| InChIKey | JLJQNKAHBZPYEU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |