About 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate
2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate (PubChem CID 22942856) has the molecular formula C18H20N2O2-2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate.
Molecular Properties
| Compound Name | 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate |
| PubChem CID | 22942856 |
| Molecular Formula | C18H20N2O2-2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate |
| SMILES | CN1C=CC(=CC2C([O-])C(C=C3C=CN(C)C=C3)C2[O-])C=C1 |
| InChI | InChI=1S/C18H20N2O2/c1-19-7-3-13(4-8-19)11-15-17(21)16(18(15)22)12-14-5-9-20(2)10-6-14/h3-12,15-18H,1-2H3/q-2 |
| InChIKey | UHEZHPPZLWEOQX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate?
The IUPAC name of 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate (CID 22942856) is 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate.
What is the SMILES notation for 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate?
The canonical SMILES for 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate is CN1C=CC(=CC2C([O-])C(C=C3C=CN(C)C=C3)C2[O-])C=C1.
What is the InChIKey of 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate?
The InChIKey is UHEZHPPZLWEOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2/c1-19-7-3-13(4-8-19)11-15-17(21)16(18(15)22)12-14-5-9-20(2)10-6-14/h3-12,15-18H,1-2H3/q-2.
What are the key properties of 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate?
2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate has a molecular weight of 296.37 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis[(1-methyl-4-pyridinylidene)methyl]cyclobutane-1,3-diolate is sourced from PubChem (CID 22942856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).