About N-ethylethanethioamide
N-ethylethanethioamide (PubChem CID 22943154) has the molecular formula C4H9NS
and a molecular weight of 103.19 g/mol. Its IUPAC name is N-ethylethanethioamide.
Molecular Properties
| Compound Name | N-ethylethanethioamide |
| PubChem CID | 22943154 |
| Molecular Formula | C4H9NS |
| Molecular Weight | 103.19 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | N-ethylethanethioamide |
| SMILES | CCNC(C)=S |
| InChI | InChI=1S/C4H9NS/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6) |
| InChIKey | JXRGNOBBIHTYBO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanethioamide?
The IUPAC name of N-ethylethanethioamide (CID 22943154) is N-ethylethanethioamide.
What is the SMILES notation for N-ethylethanethioamide?
The canonical SMILES for N-ethylethanethioamide is CCNC(C)=S.
What is the InChIKey of N-ethylethanethioamide?
The InChIKey is JXRGNOBBIHTYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6).
What are the key properties of N-ethylethanethioamide?
N-ethylethanethioamide has a molecular weight of 103.19 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanethioamide is sourced from PubChem (CID 22943154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).