C34H20F6N2O5 — CID 22943203
7-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-17-methyl-2-oxa-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone (PubChem CID 22943203) has the molecular formula C34H20F6N2O5 and a molecular weight of 650.53 g/mol. Its IUPAC name is 7-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-17-methyl-2-oxa-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone.
| Compound Name | 7-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-17-methyl-2-oxa-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 22943203 |
| Molecular Formula | C34H20F6N2O5 |
| Molecular Weight | 650.53 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 7-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]phenyl]-17-methyl-2-oxa-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),3,5(9),10,13,15(19)-hexaene-6,8,16,18-tetrone |
| SMILES | Cc1ccc(C(c2ccc(N3C(=O)c4cc5c(cc4C3=O)Oc3cc4c(cc3C5)C(=O)N(C)C4=O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H20F6N2O5/c1-16-3-5-19(6-4-16)32(33(35,36)37,34(38,39)40)20-7-9-21(10-8-20)42-30(45)23-13-18-11-17-12-22-24(29(44)41(2)28(22)43)14-26(17)47-27(18)15-25(23)31(42)46/h3-10,12-15H,11H2,1-2H3 |
| InChIKey | OPKXIEBUPAYPOX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|