C19H23NO6S — CID 22943532
[4-[3-[(4-methoxyphenyl)methoxyamino]-2-methyl-3-oxopropyl]phenyl] methanesulfonate (PubChem CID 22943532) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is [4-[3-[(4-methoxyphenyl)methoxyamino]-2-methyl-3-oxopropyl]phenyl] methanesulfonate.
| Compound Name | [4-[3-[(4-methoxyphenyl)methoxyamino]-2-methyl-3-oxopropyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 22943532 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [4-[3-[(4-methoxyphenyl)methoxyamino]-2-methyl-3-oxopropyl]phenyl] methanesulfonate |
| SMILES | COc1ccc(CONC(=O)C(C)Cc2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H23NO6S/c1-14(12-15-4-10-18(11-5-15)26-27(3,22)23)19(21)20-25-13-16-6-8-17(24-2)9-7-16/h4-11,14H,12-13H2,1-3H3,(H,20,21) |
| InChIKey | FZXZRCKQUMSFED-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|