C20H24 — CID 22943892
13-(4-methylcyclopent-2-en-1-yl)tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene (PubChem CID 22943892) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 13-(4-methylcyclopent-2-en-1-yl)tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene.
| Compound Name | 13-(4-methylcyclopent-2-en-1-yl)tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene |
|---|---|
| PubChem CID | 22943892 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 13-(4-methylcyclopent-2-en-1-yl)tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene |
| SMILES | CC1C=CC(C2CC3CC2C2c4ccccc4CC32)C1 |
| InChI | InChI=1S/C20H24/c1-12-6-7-14(8-12)17-10-15-11-19(17)20-16-5-3-2-4-13(16)9-18(15)20/h2-7,12,14-15,17-20H,8-11H2,1H3 |
| InChIKey | YBPYHFORRYAOEU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|