About 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine
6-fluoro-N-methyl-2,3-dihydrochromen-4-imine (PubChem CID 22944343) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine.
Molecular Properties
| Compound Name | 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine |
| PubChem CID | 22944343 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine |
| SMILES | C/N=C1\CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO/c1-12-9-4-5-13-10-3-2-7(11)6-8(9)10/h2-3,6H,4-5H2,1H3/b12-9+ |
| InChIKey | KWZNDWNHKHBGHP-FMIVXFBMSA-N |
| XLogP | 2.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine?
The IUPAC name of 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine (CID 22944343) is 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine.
What is the SMILES notation for 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine?
The canonical SMILES for 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine is C/N=C1\CCOc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine?
The InChIKey is KWZNDWNHKHBGHP-FMIVXFBMSA-N. The full InChI is InChI=1S/C10H10FNO/c1-12-9-4-5-13-10-3-2-7(11)6-8(9)10/h2-3,6H,4-5H2,1H3/b12-9+.
What are the key properties of 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine?
6-fluoro-N-methyl-2,3-dihydrochromen-4-imine has a molecular weight of 179.19 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-methyl-2,3-dihydrochromen-4-imine is sourced from PubChem (CID 22944343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).