methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate

C7H15NO2S — CID 22944438

IUPACmethyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate
SMILESCOC(=O)[C@@](C)(N)CCSC
InChIInChI=1S/C7H15NO2S/c1-7(8,4-5-11-3)6(9)10-2/h4-5,8H2,1-3H3/t7-/m0/s1
InChIKeyQTXVNWHVPXWBHP-ZETCQYMHSA-N
MW177.27 g/mol
LogP0.63
Rot. Bonds4

About methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate

methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate (PubChem CID 22944438) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate.

Molecular Properties

Compound Namemethyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate
PubChem CID22944438
Molecular FormulaC7H15NO2S
Molecular Weight177.27 g/mol
Exact Mass177.08
IUPAC Namemethyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate
SMILESCOC(=O)[C@@](C)(N)CCSC
InChIInChI=1S/C7H15NO2S/c1-7(8,4-5-11-3)6(9)10-2/h4-5,8H2,1-3H3/t7-/m0/s1
InChIKeyQTXVNWHVPXWBHP-ZETCQYMHSA-N
XLogP0.63
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.27
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate?
The IUPAC name of methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate (CID 22944438) is methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate.
What is the SMILES notation for methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate?
The canonical SMILES for methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate is COC(=O)[C@@](C)(N)CCSC.
What is the InChIKey of methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate?
The InChIKey is QTXVNWHVPXWBHP-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-7(8,4-5-11-3)6(9)10-2/h4-5,8H2,1-3H3/t7-/m0/s1.
What are the key properties of methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate?
methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate has a molecular weight of 177.27 g/mol, XLogP of 0.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-2-methyl-4-methylsulfanylbutanoate is sourced from PubChem (CID 22944438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).