C12H9Cl2NO4 — CID 2294455
6,8-dichloro-N-(2-hydroxyethyl)-2-oxochromene-3-carboxamide (PubChem CID 2294455) has the molecular formula C12H9Cl2NO4 and a molecular weight of 302.11 g/mol. Its IUPAC name is 6,8-dichloro-N-(2-hydroxyethyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6,8-dichloro-N-(2-hydroxyethyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 2294455 |
| Molecular Formula | C12H9Cl2NO4 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 6,8-dichloro-N-(2-hydroxyethyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCO)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C12H9Cl2NO4/c13-7-3-6-4-8(11(17)15-1-2-16)12(18)19-10(6)9(14)5-7/h3-5,16H,1-2H2,(H,15,17) |
| InChIKey | CGGZJNHYYSTIDZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|